C16H25N3O4S2 — CID 42350258
N-(2,2-diethoxyethyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide (PubChem CID 42350258) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(2,2-diethoxyethyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42350258 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-propan-2-yl-3-thiophen-2-ylpyrazole-4-sulfonamide |
| SMILES | CCOC(CNS(=O)(=O)c1cn(C(C)C)nc1-c1cccs1)OCC |
| InChI | InChI=1S/C16H25N3O4S2/c1-5-22-15(23-6-2)10-17-25(20,21)14-11-19(12(3)4)18-16(14)13-8-7-9-24-13/h7-9,11-12,15,17H,5-6,10H2,1-4H3 |
| InChIKey | ZMIRIZRDYIFBIR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|