C25H29ClN4O2S — CID 42285572
1-(5-chloro-2-methylphenyl)-4-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonylpiperazine (PubChem CID 42285572) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-4-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonylpiperazine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-4-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 42285572 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-4-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonylpiperazine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(S(=O)(=O)c2cn(C3CCCC3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29ClN4O2S/c1-19-11-12-21(26)17-23(19)28-13-15-29(16-14-28)33(31,32)24-18-30(22-9-5-6-10-22)27-25(24)20-7-3-2-4-8-20/h2-4,7-8,11-12,17-18,22H,5-6,9-10,13-16H2,1H3 |
| InChIKey | LZRGIGODGOIXNR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |