C24H27FN4O2S — CID 42285563
1-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonyl-4-(4-fluorophenyl)piperazine (PubChem CID 42285563) has the molecular formula C24H27FN4O2S and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonyl-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonyl-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 42285563 |
| Molecular Formula | C24H27FN4O2S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-(1-cyclopentyl-3-phenylpyrazol-4-yl)sulfonyl-4-(4-fluorophenyl)piperazine |
| SMILES | O=S(=O)(c1cn(C2CCCC2)nc1-c1ccccc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H27FN4O2S/c25-20-10-12-21(13-11-20)27-14-16-28(17-15-27)32(30,31)23-18-29(22-8-4-5-9-22)26-24(23)19-6-2-1-3-7-19/h1-3,6-7,10-13,18,22H,4-5,8-9,14-17H2 |
| InChIKey | TXVLHEDHMWGOPT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |