C16H21FN2O3S — CID 22719704
2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylcyclohexan-1-one (PubChem CID 22719704) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylcyclohexan-1-one.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylcyclohexan-1-one |
|---|---|
| PubChem CID | 22719704 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylcyclohexan-1-one |
| SMILES | O=C1CCCCC1S(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H21FN2O3S/c17-13-5-7-14(8-6-13)18-9-11-19(12-10-18)23(21,22)16-4-2-1-3-15(16)20/h5-8,16H,1-4,9-12H2 |
| InChIKey | HQFAJSVJTJEWBK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |