C21H20N4O4S2 — CID 4228592
2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 4228592) has the molecular formula C21H20N4O4S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 4228592 |
| Molecular Formula | C21H20N4O4S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanyl-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | Cn1/c(=N/C(=O)CSCC(=O)N2CCCc3ccccc32)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H20N4O4S2/c1-23-17-9-8-15(25(28)29)11-18(17)31-21(23)22-19(26)12-30-13-20(27)24-10-4-6-14-5-2-3-7-16(14)24/h2-3,5,7-9,11H,4,6,10,12-13H2,1H3/b22-21- |
| InChIKey | OPNHHPYULAJOAE-DQRAZIAOSA-N |
| XLogP | 3.29 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|