C17H19FN4 — CID 42286044
N-[2-(cyclohexen-1-yl)ethyl]-5-(3-fluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 42286044) has the molecular formula C17H19FN4 and a molecular weight of 298.37 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-(3-fluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(3-fluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 42286044 |
| Molecular Formula | C17H19FN4 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-(3-fluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | Fc1cccc(-c2cnnc(NCCC3=CCCCC3)n2)c1 |
| InChI | InChI=1S/C17H19FN4/c18-15-8-4-7-14(11-15)16-12-20-22-17(21-16)19-10-9-13-5-2-1-3-6-13/h4-5,7-8,11-12H,1-3,6,9-10H2,(H,19,21,22) |
| InChIKey | SPKXCDIXIVJVSU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|