C23H27N5O2 — CID 42288539
(3R)-N-[2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide (PubChem CID 42288539) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (3R)-N-[2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide.
| Compound Name | (3R)-N-[2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 42288539 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (3R)-N-[2-[1-(quinolin-8-ylmethyl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide |
| SMILES | O=C(Nc1ccnn1C1CCN(Cc2cccc3cccnc23)CC1)[C@@H]1CCOC1 |
| InChI | InChI=1S/C23H27N5O2/c29-23(19-9-14-30-16-19)26-21-6-11-25-28(21)20-7-12-27(13-8-20)15-18-4-1-3-17-5-2-10-24-22(17)18/h1-6,10-11,19-20H,7-9,12-16H2,(H,26,29)/t19-/m1/s1 |
| InChIKey | AVLUPNJLFHQYCK-LJQANCHMSA-N |
| XLogP | 3.24 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |