C25H35N5O2 — CID 42466671
(3R)-N-[2-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide (PubChem CID 42466671) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is (3R)-N-[2-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide.
| Compound Name | (3R)-N-[2-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 42466671 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (3R)-N-[2-[1-(1-benzylpiperidin-4-yl)piperidin-4-yl]pyrazol-3-yl]oxolane-3-carboxamide |
| SMILES | O=C(Nc1ccnn1C1CCN(C2CCN(Cc3ccccc3)CC2)CC1)[C@@H]1CCOC1 |
| InChI | InChI=1S/C25H35N5O2/c31-25(21-11-17-32-19-21)27-24-6-12-26-30(24)23-9-15-29(16-10-23)22-7-13-28(14-8-22)18-20-4-2-1-3-5-20/h1-6,12,21-23H,7-11,13-19H2,(H,27,31)/t21-/m1/s1 |
| InChIKey | KZQRVMMNPOLWEW-OAQYLSRUSA-N |
| XLogP | 3.16 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |