C21H31N3O2S — CID 42288875
N-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-N-ethyl-2-methylprop-2-en-1-amine (PubChem CID 42288875) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-N-ethyl-2-methylprop-2-en-1-amine.
| Compound Name | N-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-N-ethyl-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 42288875 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[[2-benzylsulfonyl-3-(2-methylpropyl)imidazol-4-yl]methyl]-N-ethyl-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CN(CC)Cc1cnc(S(=O)(=O)Cc2ccccc2)n1CC(C)C |
| InChI | InChI=1S/C21H31N3O2S/c1-6-23(13-17(2)3)15-20-12-22-21(24(20)14-18(4)5)27(25,26)16-19-10-8-7-9-11-19/h7-12,18H,2,6,13-16H2,1,3-5H3 |
| InChIKey | GBHPAUJSTXEBTI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|