C20H29N3O2S — CID 42518145
N-ethyl-N-[[2-ethylsulfonyl-3-(2-phenylethyl)imidazol-4-yl]methyl]-2-methylprop-2-en-1-amine (PubChem CID 42518145) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-ethyl-N-[[2-ethylsulfonyl-3-(2-phenylethyl)imidazol-4-yl]methyl]-2-methylprop-2-en-1-amine.
| Compound Name | N-ethyl-N-[[2-ethylsulfonyl-3-(2-phenylethyl)imidazol-4-yl]methyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 42518145 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-ethyl-N-[[2-ethylsulfonyl-3-(2-phenylethyl)imidazol-4-yl]methyl]-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CN(CC)Cc1cnc(S(=O)(=O)CC)n1CCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-5-22(15-17(3)4)16-19-14-21-20(26(24,25)6-2)23(19)13-12-18-10-8-7-9-11-18/h7-11,14H,3,5-6,12-13,15-16H2,1-2,4H3 |
| InChIKey | APYMZMOQVGFWQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|