C24H31N3O3S — CID 45223103
2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl-methylamino]-1-phenylethanol (PubChem CID 45223103) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl-methylamino]-1-phenylethanol.
| Compound Name | 2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl-methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 45223103 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl-methylamino]-1-phenylethanol |
| SMILES | CCS(=O)(=O)c1ncc(CN(C)CC(O)c2ccccc2)n1CCCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-3-31(29,30)24-25-17-22(27(24)16-10-13-20-11-6-4-7-12-20)18-26(2)19-23(28)21-14-8-5-9-15-21/h4-9,11-12,14-15,17,23,28H,3,10,13,16,18-19H2,1-2H3 |
| InChIKey | PQYUCGZSZYMWSO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |