C22H32N4O2S — CID 124838678
(8aS)-2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 124838678) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is (8aS)-2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124838678 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (8aS)-2-[[2-ethylsulfonyl-3-(3-phenylpropyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCS(=O)(=O)c1ncc(CN2CCN3CCC[C@H]3C2)n1CCCc1ccccc1 |
| InChI | InChI=1S/C22H32N4O2S/c1-2-29(27,28)22-23-16-21(18-24-14-15-25-12-7-11-20(25)17-24)26(22)13-6-10-19-8-4-3-5-9-19/h3-5,8-9,16,20H,2,6-7,10-15,17-18H2,1H3/t20-/m0/s1 |
| InChIKey | UMTYKXHPMFYJPV-FQEVSTJZSA-N |
| XLogP | 2.59 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |