C19H34N4O3S — CID 45230864
2-[[2-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 45230864) has the molecular formula C19H34N4O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is 2-[[2-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[[2-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 45230864 |
| Molecular Formula | C19H34N4O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-[[2-(2,2-dimethylpropylsulfonyl)-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COCCn1c(CN2CCN3CCCC3C2)cnc1S(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C19H34N4O3S/c1-19(2,3)15-27(24,25)18-20-12-17(23(18)10-11-26-4)14-21-8-9-22-7-5-6-16(22)13-21/h12,16H,5-11,13-15H2,1-4H3 |
| InChIKey | OAKHOZXXVTWQTP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |