C18H26N4O3S — CID 45252050
2-[1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]pyridine (PubChem CID 45252050) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]pyridine.
| Compound Name | 2-[1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 45252050 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]pyridine |
| SMILES | CCS(=O)(=O)c1ncc(CN2CCCC2c2ccccn2)n1CCOC |
| InChI | InChI=1S/C18H26N4O3S/c1-3-26(23,24)18-20-13-15(22(18)11-12-25-2)14-21-10-6-8-17(21)16-7-4-5-9-19-16/h4-5,7,9,13,17H,3,6,8,10-12,14H2,1-2H3 |
| InChIKey | DPAAIFLXEGAEKI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |