C17H31N3O4S — CID 42196986
(3R)-1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propoxypiperidine (PubChem CID 42196986) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is (3R)-1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propoxypiperidine.
| Compound Name | (3R)-1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propoxypiperidine |
|---|---|
| PubChem CID | 42196986 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (3R)-1-[[2-ethylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-3-propoxypiperidine |
| SMILES | CCCO[C@@H]1CCCN(Cc2cnc(S(=O)(=O)CC)n2CCOC)C1 |
| InChI | InChI=1S/C17H31N3O4S/c1-4-10-24-16-7-6-8-19(14-16)13-15-12-18-17(25(21,22)5-2)20(15)9-11-23-3/h12,16H,4-11,13-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | IPLOSQLWQAMTAB-MRXNPFEDSA-N |
| XLogP | 1.71 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |