C22H33N3O2S — CID 29023100
N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methyl-2-phenylethanamine (PubChem CID 29023100) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methyl-2-phenylethanamine.
| Compound Name | N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methyl-2-phenylethanamine |
|---|---|
| PubChem CID | 29023100 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-N-methyl-2-phenylethanamine |
| SMILES | CCCCn1c(CN(C)CCc2ccccc2)cnc1S(=O)(=O)CC1CCC1 |
| InChI | InChI=1S/C22H33N3O2S/c1-3-4-14-25-21(17-24(2)15-13-19-9-6-5-7-10-19)16-23-22(25)28(26,27)18-20-11-8-12-20/h5-7,9-10,16,20H,3-4,8,11-15,17-18H2,1-2H3 |
| InChIKey | NCRIAAYHYOMDNF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |