C19H33N3O2S — CID 45202844
1-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-2-methylpiperidine (PubChem CID 45202844) has the molecular formula C19H33N3O2S and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-2-methylpiperidine.
| Compound Name | 1-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 45202844 |
| Molecular Formula | C19H33N3O2S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[[3-butyl-2-(cyclobutylmethylsulfonyl)imidazol-4-yl]methyl]-2-methylpiperidine |
| SMILES | CCCCn1c(CN2CCCCC2C)cnc1S(=O)(=O)CC1CCC1 |
| InChI | InChI=1S/C19H33N3O2S/c1-3-4-12-22-18(14-21-11-6-5-8-16(21)2)13-20-19(22)25(23,24)15-17-9-7-10-17/h13,16-17H,3-12,14-15H2,1-2H3 |
| InChIKey | GWEQKLSTBMSHIN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |