C23H35N3O3S — CID 42289412
2-[benzyl-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]amino]ethanol (PubChem CID 42289412) has the molecular formula C23H35N3O3S and a molecular weight of 433.62 g/mol. Its IUPAC name is 2-[benzyl-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]amino]ethanol.
| Compound Name | 2-[benzyl-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 42289412 |
| Molecular Formula | C23H35N3O3S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[benzyl-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]amino]ethanol |
| SMILES | CCCCn1c(CN(CCO)Cc2ccccc2)cnc1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H35N3O3S/c1-2-3-14-26-21(19-25(15-16-27)18-20-10-6-4-7-11-20)17-24-23(26)30(28,29)22-12-8-5-9-13-22/h4,6-7,10-11,17,22,27H,2-3,5,8-9,12-16,18-19H2,1H3 |
| InChIKey | OHCTXWLJVOIJCN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |