C13H23N3O4S — CID 42289053
methyl 2-[methyl-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]amino]acetate (PubChem CID 42289053) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is methyl 2-[methyl-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]amino]acetate.
| Compound Name | methyl 2-[methyl-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]amino]acetate |
|---|---|
| PubChem CID | 42289053 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 2-[methyl-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]amino]acetate |
| SMILES | COC(=O)CN(C)Cc1cnc(S(C)(=O)=O)n1CC(C)C |
| InChI | InChI=1S/C13H23N3O4S/c1-10(2)7-16-11(6-14-13(16)21(5,18)19)8-15(3)9-12(17)20-4/h6,10H,7-9H2,1-5H3 |
| InChIKey | BAURZIHWMKPVGD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |