C15H27N3O4S — CID 28738563
(2R,6S)-4-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-2,6-dimethylmorpholine (PubChem CID 28738563) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is (2R,6S)-4-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 28738563 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2R,6S)-4-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-2,6-dimethylmorpholine |
| SMILES | COCCCn1c(CN2C[C@@H](C)O[C@@H](C)C2)cnc1S(C)(=O)=O |
| InChI | InChI=1S/C15H27N3O4S/c1-12-9-17(10-13(2)22-12)11-14-8-16-15(23(4,19)20)18(14)6-5-7-21-3/h8,12-13H,5-7,9-11H2,1-4H3/t12-,13+ |
| InChIKey | ARDGJYMEQJGJGN-BETUJISGSA-N |
| XLogP | 0.93 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|