C30H27ClFN3O7 — CID 4228949
8-(3-chloro-4-fluorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4228949) has the molecular formula C30H27ClFN3O7 and a molecular weight of 596.01 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4228949 |
| Molecular Formula | C30H27ClFN3O7 |
| Molecular Weight | 596.01 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(C(N)=O)C(=O)C4C3CC3C(=O)N(c4ccc(F)c(Cl)c4)C(=O)C32C)ccc1O |
| InChI | InChI=1S/C30H27ClFN3O7/c1-3-42-22-10-13(4-9-21(22)36)24-15-6-7-16-23(27(39)35(25(16)37)29(33)41)17(15)12-18-26(38)34(28(40)30(18,24)2)14-5-8-20(32)19(31)11-14/h4-6,8-11,16-18,23-24,36H,3,7,12H2,1-2H3,(H2,33,41) |
| InChIKey | MYGSDGDDHDWJRA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.01 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|