C32H25ClFN3O6 — CID 3474193
8-(3-chloro-4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 3474193) has the molecular formula C32H25ClFN3O6 and a molecular weight of 602.02 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 3474193 |
| Molecular Formula | C32H25ClFN3O6 |
| Molecular Weight | 602.02 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | CC12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C1CC1C(=CCC3C(=O)N(C(N)=O)C(=O)C31)C2c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C32H25ClFN3O6/c1-32-20(28(40)36(30(32)42)15-7-10-22(34)21(33)12-15)13-19-17(8-9-18-24(19)29(41)37(27(18)39)31(35)43)26(32)25-16-5-3-2-4-14(16)6-11-23(25)38/h2-8,10-12,18-20,24,26,38H,9,13H2,1H3,(H2,35,43) |
| InChIKey | GRVICARUKRLKDV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.02 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|