C20H35N3O4S — CID 42290040
1-[[2-cycloheptylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-4-methoxypiperidine (PubChem CID 42290040) has the molecular formula C20H35N3O4S and a molecular weight of 413.58 g/mol. Its IUPAC name is 1-[[2-cycloheptylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-4-methoxypiperidine.
| Compound Name | 1-[[2-cycloheptylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-4-methoxypiperidine |
|---|---|
| PubChem CID | 42290040 |
| Molecular Formula | C20H35N3O4S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-[[2-cycloheptylsulfonyl-3-(2-methoxyethyl)imidazol-4-yl]methyl]-4-methoxypiperidine |
| SMILES | COCCn1c(CN2CCC(OC)CC2)cnc1S(=O)(=O)C1CCCCCC1 |
| InChI | InChI=1S/C20H35N3O4S/c1-26-14-13-23-17(16-22-11-9-18(27-2)10-12-22)15-21-20(23)28(24,25)19-7-5-3-4-6-8-19/h15,18-19H,3-14,16H2,1-2H3 |
| InChIKey | BRWJMJBYKCUKSZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |