C30H26N4O9S — CID 4229500
[[2-morpholin-4-yl-3-(2-nitrophenyl)sulfanylcyclohex-2-en-1-ylidene]-(3-nitrophenyl)methyl] 3-nitrobenzoate (PubChem CID 4229500) has the molecular formula C30H26N4O9S and a molecular weight of 618.62 g/mol. Its IUPAC name is [[2-morpholin-4-yl-3-(2-nitrophenyl)sulfanylcyclohex-2-en-1-ylidene]-(3-nitrophenyl)methyl] 3-nitrobenzoate.
| Compound Name | [[2-morpholin-4-yl-3-(2-nitrophenyl)sulfanylcyclohex-2-en-1-ylidene]-(3-nitrophenyl)methyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 4229500 |
| Molecular Formula | C30H26N4O9S |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | [[2-morpholin-4-yl-3-(2-nitrophenyl)sulfanylcyclohex-2-en-1-ylidene]-(3-nitrophenyl)methyl] 3-nitrobenzoate |
| SMILES | O=C(OC(=C1CCCC(Sc2ccccc2[N+](=O)[O-])=C1N1CCOCC1)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H26N4O9S/c35-30(21-7-4-9-23(19-21)33(38)39)43-29(20-6-3-8-22(18-20)32(36)37)24-10-5-13-27(28(24)31-14-16-42-17-15-31)44-26-12-2-1-11-25(26)34(40)41/h1-4,6-9,11-12,18-19H,5,10,13-17H2 |
| InChIKey | KJDVSTDYUMSNQC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 168.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|