C18H24N4O3S2 — CID 4230092
N-(2-acetamidoethyl)-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 4230092) has the molecular formula C18H24N4O3S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4230092 |
| Molecular Formula | C18H24N4O3S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1CCC(Cn2c(=S)[nH]c3ccsc3c2=O)CC1 |
| InChI | InChI=1S/C18H24N4O3S2/c1-11(23)19-7-8-20-16(24)13-4-2-12(3-5-13)10-22-17(25)15-14(6-9-27-15)21-18(22)26/h6,9,12-13H,2-5,7-8,10H2,1H3,(H,19,23)(H,20,24)(H,21,26) |
| InChIKey | XMTYTHZSSQGCRB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|