C25H32N4O2S2 — CID 126479241
N-[3-(N-ethylanilino)propyl]-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 126479241) has the molecular formula C25H32N4O2S2 and a molecular weight of 484.69 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 126479241 |
| Molecular Formula | C25H32N4O2S2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-4-[(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | CCN(CCCNC(=O)C1CCC(Cn2c(=S)[nH]c3ccsc3c2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O2S2/c1-2-28(20-7-4-3-5-8-20)15-6-14-26-23(30)19-11-9-18(10-12-19)17-29-24(31)22-21(13-16-33-22)27-25(29)32/h3-5,7-8,13,16,18-19H,2,6,9-12,14-15,17H2,1H3,(H,26,30)(H,27,32) |
| InChIKey | ZMSNHONXSZIXPR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|