C25H31N5O3S — CID 42319783
N-[(1R,2R)-2-methoxy-1'-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]propanamide (PubChem CID 42319783) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[(1R,2R)-2-methoxy-1'-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]propanamide.
| Compound Name | N-[(1R,2R)-2-methoxy-1'-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]propanamide |
|---|---|
| PubChem CID | 42319783 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[(1R,2R)-2-methoxy-1'-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]propanamide |
| SMILES | CCC(=O)N[C@@H]1c2ccccc2C2(CCN(Cc3ccc(Sc4nncn4C)o3)CC2)[C@H]1OC |
| InChI | InChI=1S/C25H31N5O3S/c1-4-20(31)27-22-18-7-5-6-8-19(18)25(23(22)32-3)11-13-30(14-12-25)15-17-9-10-21(33-17)34-24-28-26-16-29(24)2/h5-10,16,22-23H,4,11-15H2,1-3H3,(H,27,31)/t22-,23+/m1/s1 |
| InChIKey | HEQLGBHFZVYMHN-PKTZIBPZSA-N |
| XLogP | 3.69 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |