C25H32FN5O — CID 42328813
N-[[7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-(3-fluorophenyl)acetamide (PubChem CID 42328813) has the molecular formula C25H32FN5O and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[[7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[[7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 42328813 |
| Molecular Formula | C25H32FN5O |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-[[7-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCc4nnc(CNC(=O)Cc5cccc(F)c5)n4CC3)[C@@H]1C2 |
| InChI | InChI=1S/C25H32FN5O/c1-25(2)19-7-6-18(21(25)14-19)16-30-9-8-22-28-29-23(31(22)11-10-30)15-27-24(32)13-17-4-3-5-20(26)12-17/h3-6,12,19,21H,7-11,13-16H2,1-2H3,(H,27,32)/t19-,21-/m0/s1 |
| InChIKey | VLZRFEUFZZLGFV-FPOVZHCZSA-N |
| XLogP | 3.13 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|