C25H31N5O2 — CID 45251195
2-methyl-N-[[7-[(3-phenoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]butanamide (PubChem CID 45251195) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-methyl-N-[[7-[(3-phenoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]butanamide.
| Compound Name | 2-methyl-N-[[7-[(3-phenoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 45251195 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-methyl-N-[[7-[(3-phenoxyphenyl)methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]butanamide |
| SMILES | CCC(C)C(=O)NCc1nnc2n1CCN(Cc1cccc(Oc3ccccc3)c1)CC2 |
| InChI | InChI=1S/C25H31N5O2/c1-3-19(2)25(31)26-17-24-28-27-23-12-13-29(14-15-30(23)24)18-20-8-7-11-22(16-20)32-21-9-5-4-6-10-21/h4-11,16,19H,3,12-15,17-18H2,1-2H3,(H,26,31) |
| InChIKey | IYBXHSHJBCAGFL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |