C28H32N6O2 — CID 42432031
2,5-dimethyl-N-[[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]furan-3-carboxamide (PubChem CID 42432031) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 42432031 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2,5-dimethyl-N-[[7-[[4-(N-methylanilino)phenyl]methyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2nnc3n2CCN(Cc2ccc(N(C)c4ccccc4)cc2)CC3)c(C)o1 |
| InChI | InChI=1S/C28H32N6O2/c1-20-17-25(21(2)36-20)28(35)29-18-27-31-30-26-13-14-33(15-16-34(26)27)19-22-9-11-24(12-10-22)32(3)23-7-5-4-6-8-23/h4-12,17H,13-16,18-19H2,1-3H3,(H,29,35) |
| InChIKey | URUBGVQFPLYLDK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |