C23H35N5O2 — CID 45226505
N-[[7-(2,6-dimethylhept-5-enyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 45226505) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[[7-(2,6-dimethylhept-5-enyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[[7-(2,6-dimethylhept-5-enyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 45226505 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-[[7-(2,6-dimethylhept-5-enyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]methyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | CC(C)=CCCC(C)CN1CCc2nnc(CNC(=O)c3cc(C)oc3C)n2CC1 |
| InChI | InChI=1S/C23H35N5O2/c1-16(2)7-6-8-17(3)15-27-10-9-21-25-26-22(28(21)12-11-27)14-24-23(29)20-13-18(4)30-19(20)5/h7,13,17H,6,8-12,14-15H2,1-5H3,(H,24,29) |
| InChIKey | AZWYUZJTAYIZQH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|