C16H13Cl2N3OS — CID 42329683
3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole (PubChem CID 42329683) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 42329683 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
| SMILES | C=CCSc1nnc(-c2ccc(Cl)cc2Cl)n1Cc1ccco1 |
| InChI | InChI=1S/C16H13Cl2N3OS/c1-2-8-23-16-20-19-15(13-6-5-11(17)9-14(13)18)21(16)10-12-4-3-7-22-12/h2-7,9H,1,8,10H2 |
| InChIKey | OBTICMJMEDVRDM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|