C20H26N6O3S — CID 42334485
2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-methyl-N-(4-nitrophenyl)acetamide (PubChem CID 42334485) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-methyl-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-methyl-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42334485 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-methyl-N-(4-nitrophenyl)acetamide |
| SMILES | CC1CCN(c2nnc(SCC(=O)N(C)c3ccc([N+](=O)[O-])cc3)n2C2CC2)CC1 |
| InChI | InChI=1S/C20H26N6O3S/c1-14-9-11-24(12-10-14)19-21-22-20(25(19)16-5-6-16)30-13-18(27)23(2)15-3-7-17(8-4-15)26(28)29/h3-4,7-8,14,16H,5-6,9-13H2,1-2H3 |
| InChIKey | FNVCQXZXKMVWQN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|