C17H13ClFN3S — CID 42336365
N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 42336365) has the molecular formula C17H13ClFN3S and a molecular weight of 345.83 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 42336365 |
| Molecular Formula | C17H13ClFN3S |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-4-(4-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2csc(N/N=C\c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C17H13ClFN3S/c1-11-5-7-12(8-6-11)16-10-23-17(21-16)22-20-9-13-14(18)3-2-4-15(13)19/h2-10H,1H3,(H,21,22)/b20-9- |
| InChIKey | FCEZYMCEAMNQAO-UKWGHVSLSA-N |
| XLogP | 5.36 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|