C21H27NO3 — CID 42341709
[1-[(E)-3-(furan-2-yl)prop-2-enyl]-4-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol (PubChem CID 42341709) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [1-[(E)-3-(furan-2-yl)prop-2-enyl]-4-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol.
| Compound Name | [1-[(E)-3-(furan-2-yl)prop-2-enyl]-4-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 42341709 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [1-[(E)-3-(furan-2-yl)prop-2-enyl]-4-[(4-methoxyphenyl)methyl]piperidin-4-yl]methanol |
| SMILES | COc1ccc(CC2(CO)CCN(C/C=C/c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-24-19-8-6-18(7-9-19)16-21(17-23)10-13-22(14-11-21)12-2-4-20-5-3-15-25-20/h2-9,15,23H,10-14,16-17H2,1H3/b4-2+ |
| InChIKey | NVHWMZZWEODRFQ-DUXPYHPUSA-N |
| XLogP | 3.62 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |