C20H27NO2 — CID 135103504
9-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene (PubChem CID 135103504) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 9-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene.
| Compound Name | 9-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 135103504 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 9-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-4-methyl-1-oxa-9-azaspiro[5.5]undec-4-ene |
| SMILES | COc1ccc(/C=C/CN2CCC3(C=C(C)CCO3)CC2)cc1 |
| InChI | InChI=1S/C20H27NO2/c1-17-9-15-23-20(16-17)10-13-21(14-11-20)12-3-4-18-5-7-19(22-2)8-6-18/h3-8,16H,9-15H2,1-2H3/b4-3+ |
| InChIKey | XPBCIHPHPVPTBJ-ONEGZZNKSA-N |
| XLogP | 3.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|