C19H27NO2 — CID 171134843
2-[3-(4-methoxyphenyl)prop-2-enyl]-9-oxa-2-azaspiro[5.5]undecane (PubChem CID 171134843) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)prop-2-enyl]-9-oxa-2-azaspiro[5.5]undecane.
| Compound Name | 2-[3-(4-methoxyphenyl)prop-2-enyl]-9-oxa-2-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 171134843 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)prop-2-enyl]-9-oxa-2-azaspiro[5.5]undecane |
| SMILES | COc1ccc(C=CCN2CCCC3(CCOCC3)C2)cc1 |
| InChI | InChI=1S/C19H27NO2/c1-21-18-7-5-17(6-8-18)4-2-12-20-13-3-9-19(16-20)10-14-22-15-11-19/h2,4-8H,3,9-16H2,1H3 |
| InChIKey | FAXDHNIWJUVNJL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |