C19H26N2O3 — CID 56902690
(4aS,8aR)-6-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid (PubChem CID 56902690) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (4aS,8aR)-6-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aR)-6-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 56902690 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (4aS,8aR)-6-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,2,3,4,5,7,8,8a-octahydro-1,6-naphthyridine-4a-carboxylic acid |
| SMILES | COc1ccc(/C=C/CN2CC[C@H]3NCCC[C@]3(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-24-16-7-5-15(6-8-16)4-2-12-21-13-9-17-19(14-21,18(22)23)10-3-11-20-17/h2,4-8,17,20H,3,9-14H2,1H3,(H,22,23)/b4-2+/t17-,19+/m1/s1 |
| InChIKey | RCGCEIZFPDHKJH-CSGFNCJESA-N |
| XLogP | 2.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |