C24H34N2O3 — CID 72878062
[(4aR,8aR)-4a-hydroxy-7-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone (PubChem CID 72878062) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is [(4aR,8aR)-4a-hydroxy-7-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone.
| Compound Name | [(4aR,8aR)-4a-hydroxy-7-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 72878062 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | [(4aR,8aR)-4a-hydroxy-7-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone |
| SMILES | COc1ccc(/C=C/CN2CC[C@@]3(O)CCN(C(=O)C4CCCC4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C24H34N2O3/c1-29-22-10-8-19(9-11-22)5-4-14-25-15-12-24(28)13-16-26(18-21(24)17-25)23(27)20-6-2-3-7-20/h4-5,8-11,20-21,28H,2-3,6-7,12-18H2,1H3/b5-4+/t21-,24-/m1/s1 |
| InChIKey | SZTRHULWCWCOAF-NQSYBFAHSA-N |
| XLogP | 3.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |