C22H32N2O3 — CID 72931009
[(4aR,8aR)-4a-hydroxy-7-(2-phenoxyethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone (PubChem CID 72931009) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(4aR,8aR)-4a-hydroxy-7-(2-phenoxyethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone.
| Compound Name | [(4aR,8aR)-4a-hydroxy-7-(2-phenoxyethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 72931009 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | [(4aR,8aR)-4a-hydroxy-7-(2-phenoxyethyl)-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CC[C@]2(O)CCN(CCOc3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H32N2O3/c25-21(18-6-4-5-7-18)24-13-11-22(26)10-12-23(16-19(22)17-24)14-15-27-20-8-2-1-3-9-20/h1-3,8-9,18-19,26H,4-7,10-17H2/t19-,22-/m1/s1 |
| InChIKey | LNKBFVNDZINUEH-DENIHFKCSA-N |
| XLogP | 2.54 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |