C23H34N2O2 — CID 72837710
[(4aR,8aR)-4a-hydroxy-7-[(2,4,5-trimethylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone (PubChem CID 72837710) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [(4aR,8aR)-4a-hydroxy-7-[(2,4,5-trimethylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone.
| Compound Name | [(4aR,8aR)-4a-hydroxy-7-[(2,4,5-trimethylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 72837710 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | [(4aR,8aR)-4a-hydroxy-7-[(2,4,5-trimethylphenyl)methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
| SMILES | Cc1cc(C)c(CN2CC[C@@]3(O)CCN(C(=O)C4CCC4)C[C@H]3C2)cc1C |
| InChI | InChI=1S/C23H34N2O2/c1-16-11-18(3)20(12-17(16)2)13-24-9-7-23(27)8-10-25(15-21(23)14-24)22(26)19-5-4-6-19/h11-12,19,21,27H,4-10,13-15H2,1-3H3/t21-,23-/m1/s1 |
| InChIKey | BBVXWEIVBHQDIH-FYYLOGMGSA-N |
| XLogP | 3.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |