C21H27F3N2O2 — CID 133134930
[(4aS,8aS)-4a-hydroxy-7-[[4-(trifluoromethyl)phenyl]methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone (PubChem CID 133134930) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is [(4aS,8aS)-4a-hydroxy-7-[[4-(trifluoromethyl)phenyl]methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone.
| Compound Name | [(4aS,8aS)-4a-hydroxy-7-[[4-(trifluoromethyl)phenyl]methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 133134930 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(4aS,8aS)-4a-hydroxy-7-[[4-(trifluoromethyl)phenyl]methyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CC[C@@]2(O)CCN(Cc3ccc(C(F)(F)F)cc3)C[C@H]2C1 |
| InChI | InChI=1S/C21H27F3N2O2/c22-21(23,24)17-6-4-15(5-7-17)12-25-10-8-20(28)9-11-26(14-18(20)13-25)19(27)16-2-1-3-16/h4-7,16,18,28H,1-3,8-14H2/t18-,20-/m0/s1 |
| InChIKey | GIHIBHZHTGNMNA-ICSRJNTNSA-N |
| XLogP | 3.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |