C20H26F2N2O2 — CID 72853574
[(4aR,8aR)-7-[(2,3-difluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone (PubChem CID 72853574) has the molecular formula C20H26F2N2O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(4aR,8aR)-7-[(2,3-difluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone.
| Compound Name | [(4aR,8aR)-7-[(2,3-difluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 72853574 |
| Molecular Formula | C20H26F2N2O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [(4aR,8aR)-7-[(2,3-difluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CC[C@]2(O)CCN(Cc3cccc(F)c3F)C[C@@H]2C1 |
| InChI | InChI=1S/C20H26F2N2O2/c21-17-6-2-5-15(18(17)22)11-23-9-7-20(26)8-10-24(13-16(20)12-23)19(25)14-3-1-4-14/h2,5-6,14,16,26H,1,3-4,7-13H2/t16-,20-/m1/s1 |
| InChIKey | AHZIELNBTCHJLW-OXQOHEQNSA-N |
| XLogP | 2.55 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |