C23H32N2O3 — CID 91940762
[(4aR,8aR)-4a-hydroxy-7-[3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone (PubChem CID 91940762) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(4aR,8aR)-4a-hydroxy-7-[3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone.
| Compound Name | [(4aR,8aR)-4a-hydroxy-7-[3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 91940762 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | [(4aR,8aR)-4a-hydroxy-7-[3-(4-methoxyphenyl)prop-2-enyl]-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
| SMILES | COc1ccc(C=CCN2CC[C@@]3(O)CCN(C(=O)C4CCC4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-28-21-9-7-18(8-10-21)4-3-13-24-14-11-23(27)12-15-25(17-20(23)16-24)22(26)19-5-2-6-19/h3-4,7-10,19-20,27H,2,5-6,11-17H2,1H3/t20-,23-/m1/s1 |
| InChIKey | WAHIXZMBTDHGBH-NFBKMPQASA-N |
| XLogP | 2.79 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |