C20H26ClFN2O2 — CID 133126999
[(4aS,8aS)-7-[(2-chloro-5-fluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone (PubChem CID 133126999) has the molecular formula C20H26ClFN2O2 and a molecular weight of 380.89 g/mol. Its IUPAC name is [(4aS,8aS)-7-[(2-chloro-5-fluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone.
| Compound Name | [(4aS,8aS)-7-[(2-chloro-5-fluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 133126999 |
| Molecular Formula | C20H26ClFN2O2 |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(4aS,8aS)-7-[(2-chloro-5-fluorophenyl)methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CC[C@@]2(O)CCN(Cc3cc(F)ccc3Cl)C[C@H]2C1 |
| InChI | InChI=1S/C20H26ClFN2O2/c21-18-5-4-17(22)10-15(18)11-23-8-6-20(26)7-9-24(13-16(20)12-23)19(25)14-2-1-3-14/h4-5,10,14,16,26H,1-3,6-9,11-13H2/t16-,20-/m0/s1 |
| InChIKey | KVJKKGUZFLXKHI-JXFKEZNVSA-N |
| XLogP | 3.06 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |