C19H24ClFN2O2 — CID 72896381
(3aR,6aR)-5-[(2-chloro-5-fluorophenyl)methyl]-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72896381) has the molecular formula C19H24ClFN2O2 and a molecular weight of 366.86 g/mol. Its IUPAC name is (3aR,6aR)-5-[(2-chloro-5-fluorophenyl)methyl]-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[(2-chloro-5-fluorophenyl)methyl]-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72896381 |
| Molecular Formula | C19H24ClFN2O2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3aR,6aR)-5-[(2-chloro-5-fluorophenyl)methyl]-2-(cyclobutylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@]12CN(Cc3cc(F)ccc3Cl)C[C@H]1CN(CC1CCC1)C2 |
| InChI | InChI=1S/C19H24ClFN2O2/c20-17-5-4-16(21)6-14(17)8-23-10-15-9-22(7-13-2-1-3-13)11-19(15,12-23)18(24)25/h4-6,13,15H,1-3,7-12H2,(H,24,25)/t15-,19-/m1/s1 |
| InChIKey | XAOQURGWOJEMRF-DNVCBOLYSA-N |
| XLogP | 3.10 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |