C15H18ClFN2O4S — CID 72840768
(3aR,6aR)-2-[(2-chloro-4-fluorophenyl)methyl]-5-methylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72840768) has the molecular formula C15H18ClFN2O4S and a molecular weight of 376.84 g/mol. Its IUPAC name is (3aR,6aR)-2-[(2-chloro-4-fluorophenyl)methyl]-5-methylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-[(2-chloro-4-fluorophenyl)methyl]-5-methylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72840768 |
| Molecular Formula | C15H18ClFN2O4S |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (3aR,6aR)-2-[(2-chloro-4-fluorophenyl)methyl]-5-methylsulfonyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CS(=O)(=O)N1C[C@H]2CN(Cc3ccc(F)cc3Cl)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C15H18ClFN2O4S/c1-24(22,23)19-7-11-6-18(8-15(11,9-19)14(20)21)5-10-2-3-12(17)4-13(10)16/h2-4,11H,5-9H2,1H3,(H,20,21)/t11-,15-/m1/s1 |
| InChIKey | CZENJJVRLOFLMU-IAQYHMDHSA-N |
| XLogP | 1.26 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |