C20H30N2O2 — CID 70771000
1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol (PubChem CID 70771000) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol.
| Compound Name | 1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 70771000 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-3-(pyrrolidin-1-ylmethyl)piperidin-3-ol |
| SMILES | COc1ccc(/C=C/CN2CCCC(O)(CN3CCCC3)C2)cc1 |
| InChI | InChI=1S/C20H30N2O2/c1-24-19-9-7-18(8-10-19)6-4-14-22-15-5-11-20(23,17-22)16-21-12-2-3-13-21/h4,6-10,23H,2-3,5,11-17H2,1H3/b6-4+ |
| InChIKey | ZGNWZEZARBQBCG-GQCTYLIASA-N |
| XLogP | 2.63 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |