C18H24N2O5 — CID 4234432
N-(3,4-dimethoxyphenyl)-2-(3-oxo-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-4-yl)acetamide (PubChem CID 4234432) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(3-oxo-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-4-yl)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(3-oxo-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 4234432 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(3-oxo-4,6,7,8,9,9a-hexahydro-1H-pyrido[2,1-c][1,4]oxazin-4-yl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2C(=O)OCC3CCCCN32)cc1OC |
| InChI | InChI=1S/C18H24N2O5/c1-23-15-7-6-12(9-16(15)24-2)19-17(21)10-14-18(22)25-11-13-5-3-4-8-20(13)14/h6-7,9,13-14H,3-5,8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | AQGJEVHERCJSMX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |