C23H33N3O — CID 42345611
3-(4-cyclohexylphenyl)-4-[[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]methyl]-1-methylpyrazole (PubChem CID 42345611) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 3-(4-cyclohexylphenyl)-4-[[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]methyl]-1-methylpyrazole.
| Compound Name | 3-(4-cyclohexylphenyl)-4-[[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 42345611 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 3-(4-cyclohexylphenyl)-4-[[(3S)-3-(methoxymethyl)pyrrolidin-1-yl]methyl]-1-methylpyrazole |
| SMILES | COC[C@H]1CCN(Cc2cn(C)nc2-c2ccc(C3CCCCC3)cc2)C1 |
| InChI | InChI=1S/C23H33N3O/c1-25-15-22(16-26-13-12-18(14-26)17-27-2)23(24-25)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h8-11,15,18-19H,3-7,12-14,16-17H2,1-2H3/t18-/m0/s1 |
| InChIKey | LVXFIPBFRIGEDK-SFHVURJKSA-N |
| XLogP | 4.60 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |